C12H12ClFN2O2S — CID 75477617
4-chloro-N-(1-cyanocyclobutyl)-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 75477617) has the molecular formula C12H12ClFN2O2S and a molecular weight of 302.76 g/mol. Its IUPAC name is 4-chloro-N-(1-cyanocyclobutyl)-2-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(1-cyanocyclobutyl)-2-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 75477617 |
| Molecular Formula | C12H12ClFN2O2S |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 4-chloro-N-(1-cyanocyclobutyl)-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1(C#N)CCC1)S(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H12ClFN2O2S/c1-16(12(8-15)5-2-6-12)19(17,18)11-4-3-9(13)7-10(11)14/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | QSBXMLUDQJYGJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |