C19H22N4O3 — CID 75480220
(E)-3-(1,3-benzodioxol-5-yl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)prop-2-enamide (PubChem CID 75480220) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75480220 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)prop-2-enamide |
| SMILES | CC(C)c1nnc2n1CC(NC(=O)/C=C/c1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C19H22N4O3/c1-12(2)19-22-21-17-7-5-14(10-23(17)19)20-18(24)8-4-13-3-6-15-16(9-13)26-11-25-15/h3-4,6,8-9,12,14H,5,7,10-11H2,1-2H3,(H,20,24)/b8-4+ |
| InChIKey | KITRPGKTJFGZEL-XBXARRHUSA-N |
| XLogP | 2.27 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|