C14H22ClNOS — CID 75482653
N-[(4-chloro-2,6-dimethylphenyl)methyl]-3-methylsulfinylbutan-1-amine (PubChem CID 75482653) has the molecular formula C14H22ClNOS and a molecular weight of 287.86 g/mol. Its IUPAC name is N-[(4-chloro-2,6-dimethylphenyl)methyl]-3-methylsulfinylbutan-1-amine.
| Compound Name | N-[(4-chloro-2,6-dimethylphenyl)methyl]-3-methylsulfinylbutan-1-amine |
|---|---|
| PubChem CID | 75482653 |
| Molecular Formula | C14H22ClNOS |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[(4-chloro-2,6-dimethylphenyl)methyl]-3-methylsulfinylbutan-1-amine |
| SMILES | Cc1cc(Cl)cc(C)c1CNCCC(C)S(C)=O |
| InChI | InChI=1S/C14H22ClNOS/c1-10-7-13(15)8-11(2)14(10)9-16-6-5-12(3)18(4)17/h7-8,12,16H,5-6,9H2,1-4H3 |
| InChIKey | DDTLBJOMCAUTPK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|