About N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide
N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide (PubChem CID 75484697) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide.
Molecular Properties
| Compound Name | N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide |
| PubChem CID | 75484697 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide |
| SMILES | Cc1cc(C)cc(CCC(=O)Nc2c(C)noc2C2CC2)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-11-8-12(2)10-14(9-11)4-7-16(21)19-17-13(3)20-22-18(17)15-5-6-15/h8-10,15H,4-7H2,1-3H3,(H,19,21) |
| InChIKey | GVVACSVJSASYNG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide?
The IUPAC name of N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide (CID 75484697) is N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide.
What is the SMILES notation for N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide?
The canonical SMILES for N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide is Cc1cc(C)cc(CCC(=O)Nc2c(C)noc2C2CC2)c1.
What is the InChIKey of N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide?
The InChIKey is GVVACSVJSASYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-11-8-12(2)10-14(9-11)4-7-16(21)19-17-13(3)20-22-18(17)15-5-6-15/h8-10,15H,4-7H2,1-3H3,(H,19,21).
What are the key properties of N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide?
N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide has a molecular weight of 298.39 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)-3-(3,5-dimethylphenyl)propanamide is sourced from PubChem (CID 75484697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).