C10H11BClN3O2 — CID 75485989
[1-(3-chloro-2-pyridinyl)-3,5-dimethylpyrazol-4-yl]boronic acid (PubChem CID 75485989) has the molecular formula C10H11BClN3O2 and a molecular weight of 251.48 g/mol. Its IUPAC name is [1-(3-chloro-2-pyridinyl)-3,5-dimethylpyrazol-4-yl]boronic acid.
| Compound Name | [1-(3-chloro-2-pyridinyl)-3,5-dimethylpyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 75485989 |
| Molecular Formula | C10H11BClN3O2 |
| Molecular Weight | 251.48 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | [1-(3-chloro-2-pyridinyl)-3,5-dimethylpyrazol-4-yl]boronic acid |
| SMILES | Cc1nn(-c2ncccc2Cl)c(C)c1B(O)O |
| InChI | InChI=1S/C10H11BClN3O2/c1-6-9(11(16)17)7(2)15(14-6)10-8(12)4-3-5-13-10/h3-5,16-17H,1-2H3 |
| InChIKey | VCLAFYLWXUYNON-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.48 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|