C23H27NO4 — CID 75493019
(4S)-4-amino-8-(9H-fluoren-9-ylmethoxy)-6-methyl-8-oxooctanoic acid (PubChem CID 75493019) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (4S)-4-amino-8-(9H-fluoren-9-ylmethoxy)-6-methyl-8-oxooctanoic acid.
| Compound Name | (4S)-4-amino-8-(9H-fluoren-9-ylmethoxy)-6-methyl-8-oxooctanoic acid |
|---|---|
| PubChem CID | 75493019 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (4S)-4-amino-8-(9H-fluoren-9-ylmethoxy)-6-methyl-8-oxooctanoic acid |
| SMILES | CC(CC(=O)OCC1c2ccccc2-c2ccccc21)C[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C23H27NO4/c1-15(12-16(24)10-11-22(25)26)13-23(27)28-14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-9,15-16,21H,10-14,24H2,1H3,(H,25,26)/t15?,16-/m0/s1 |
| InChIKey | LYSYCJYHXQLCNW-LYKKTTPLSA-N |
| XLogP | 3.95 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |