C17H11F3N2O2 — CID 75500953
2,4,5-trifluoro-3-hydroxy-N-(quinolin-4-ylmethyl)benzamide (PubChem CID 75500953) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-(quinolin-4-ylmethyl)benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-(quinolin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 75500953 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-(quinolin-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccnc2ccccc12)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C17H11F3N2O2/c18-12-7-11(14(19)16(23)15(12)20)17(24)22-8-9-5-6-21-13-4-2-1-3-10(9)13/h1-7,23H,8H2,(H,22,24) |
| InChIKey | IPVFRQMVZVKUIY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|