C16H15F3N2O3 — CID 86789939
2,4,5-trifluoro-3-hydroxy-N-[(2-propoxy-4-pyridinyl)methyl]benzamide (PubChem CID 86789939) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-[(2-propoxy-4-pyridinyl)methyl]benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-[(2-propoxy-4-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 86789939 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-[(2-propoxy-4-pyridinyl)methyl]benzamide |
| SMILES | CCCOc1cc(CNC(=O)c2cc(F)c(F)c(O)c2F)ccn1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-2-5-24-12-6-9(3-4-20-12)8-21-16(23)10-7-11(17)14(19)15(22)13(10)18/h3-4,6-7,22H,2,5,8H2,1H3,(H,21,23) |
| InChIKey | NSHFULBTDWAFTH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|