C15H10F3N3O2 — CID 75503771
2,3,4-trifluoro-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]benzamide (PubChem CID 75503771) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 75503771 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc2[nH]c(=O)[nH]c2c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10F3N3O2/c16-9-3-2-8(12(17)13(9)18)14(22)19-6-7-1-4-10-11(5-7)21-15(23)20-10/h1-5H,6H2,(H,19,22)(H2,20,21,23) |
| InChIKey | MEGJTMFGJLTNTJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|