C11H8F3N3O2 — CID 84582600
2,3,4-trifluoro-N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]benzamide (PubChem CID 84582600) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 84582600 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc(=O)[nH][nH]1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H8F3N3O2/c12-7-2-1-6(9(13)10(7)14)11(19)15-4-5-3-8(18)17-16-5/h1-3H,4H2,(H,15,19)(H2,16,17,18) |
| InChIKey | BEFGYDVDTARYSY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|