C14H18BrNO3 — CID 75507578
methyl 4-[(2-bromo-3,5-dimethylbenzoyl)amino]butanoate (PubChem CID 75507578) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is methyl 4-[(2-bromo-3,5-dimethylbenzoyl)amino]butanoate.
| Compound Name | methyl 4-[(2-bromo-3,5-dimethylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 75507578 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | methyl 4-[(2-bromo-3,5-dimethylbenzoyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cc(C)cc(C)c1Br |
| InChI | InChI=1S/C14H18BrNO3/c1-9-7-10(2)13(15)11(8-9)14(18)16-6-4-5-12(17)19-3/h7-8H,4-6H2,1-3H3,(H,16,18) |
| InChIKey | BBJGKYNXNKRKES-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|