C11H14ClNO3S — CID 75510156
[1-(2-chloro-5-methylphenyl)sulfonylazetidin-3-yl]methanol (PubChem CID 75510156) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is [1-(2-chloro-5-methylphenyl)sulfonylazetidin-3-yl]methanol.
| Compound Name | [1-(2-chloro-5-methylphenyl)sulfonylazetidin-3-yl]methanol |
|---|---|
| PubChem CID | 75510156 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | [1-(2-chloro-5-methylphenyl)sulfonylazetidin-3-yl]methanol |
| SMILES | Cc1ccc(Cl)c(S(=O)(=O)N2CC(CO)C2)c1 |
| InChI | InChI=1S/C11H14ClNO3S/c1-8-2-3-10(12)11(4-8)17(15,16)13-5-9(6-13)7-14/h2-4,9,14H,5-7H2,1H3 |
| InChIKey | VKYOPWZUFBRULE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |