C12H18N2O3S — CID 75510377
N-[(2,5-diethylphenyl)sulfamoyl]acetamide (PubChem CID 75510377) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-[(2,5-diethylphenyl)sulfamoyl]acetamide.
| Compound Name | N-[(2,5-diethylphenyl)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 75510377 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-[(2,5-diethylphenyl)sulfamoyl]acetamide |
| SMILES | CCc1ccc(CC)c(NS(=O)(=O)NC(C)=O)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-4-10-6-7-11(5-2)12(8-10)14-18(16,17)13-9(3)15/h6-8,14H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | WBUDWDUDRINUAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |