C16H23BrN2O2 — CID 75512046
5-[(3-bromo-1-adamantyl)methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole (PubChem CID 75512046) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 5-[(3-bromo-1-adamantyl)methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(3-bromo-1-adamantyl)methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 75512046 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-[(3-bromo-1-adamantyl)methyl]-3-(2-methoxyethyl)-1,2,4-oxadiazole |
| SMILES | COCCc1noc(CC23CC4CC(CC(Br)(C4)C2)C3)n1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-20-3-2-13-18-14(21-19-13)9-15-5-11-4-12(6-15)8-16(17,7-11)10-15/h11-12H,2-10H2,1H3 |
| InChIKey | RNHNADWBSPOKEE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|