C16H19N3O2 — CID 75515894
N-[1-(2,4-dimethylpyrimidin-5-yl)ethyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 75515894) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[1-(2,4-dimethylpyrimidin-5-yl)ethyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[1-(2,4-dimethylpyrimidin-5-yl)ethyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 75515894 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[1-(2,4-dimethylpyrimidin-5-yl)ethyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Cc1ncc(C(C)Nc2ccc3c(c2)OCCO3)c(C)n1 |
| InChI | InChI=1S/C16H19N3O2/c1-10-14(9-17-12(3)18-10)11(2)19-13-4-5-15-16(8-13)21-7-6-20-15/h4-5,8-9,11,19H,6-7H2,1-3H3 |
| InChIKey | OWMRJONENABPLT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|