C10H8ClF2NO3S — CID 75522733
N-(2-chloroprop-2-enylsulfonyl)-2,3-difluorobenzamide (PubChem CID 75522733) has the molecular formula C10H8ClF2NO3S and a molecular weight of 295.69 g/mol. Its IUPAC name is N-(2-chloroprop-2-enylsulfonyl)-2,3-difluorobenzamide.
| Compound Name | N-(2-chloroprop-2-enylsulfonyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 75522733 |
| Molecular Formula | C10H8ClF2NO3S |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | N-(2-chloroprop-2-enylsulfonyl)-2,3-difluorobenzamide |
| SMILES | C=C(Cl)CS(=O)(=O)NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H8ClF2NO3S/c1-6(11)5-18(16,17)14-10(15)7-3-2-4-8(12)9(7)13/h2-4H,1,5H2,(H,14,15) |
| InChIKey | KNJXUNMGNYCTNM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |