C22H24N4O3 — CID 75588310
9-[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]-1,6,8,9-tetrahydropyrido[3,2-g][1,4]benzoxazine-2,7-dione (PubChem CID 75588310) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 9-[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]-1,6,8,9-tetrahydropyrido[3,2-g][1,4]benzoxazine-2,7-dione.
| Compound Name | 9-[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]-1,6,8,9-tetrahydropyrido[3,2-g][1,4]benzoxazine-2,7-dione |
|---|---|
| PubChem CID | 75588310 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 9-[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]-1,6,8,9-tetrahydropyrido[3,2-g][1,4]benzoxazine-2,7-dione |
| SMILES | Cc1ccc(C)c(C2NNCC2C2CC(=O)Nc3cc4c(cc32)NC(=O)CO4)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-11-3-4-12(2)13(5-11)22-16(9-23-26-22)14-7-20(27)24-17-8-19-18(6-15(14)17)25-21(28)10-29-19/h3-6,8,14,16,22-23,26H,7,9-10H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | AKQVUEAOESKPRI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |