4-oxo-3H-quinoline-3,6-dicarboxylic acid

C11H7NO5 — CID 75682864

IUPAC4-oxo-3H-quinoline-3,6-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(=O)C(C(=O)O)C=N2
InChIInChI=1S/C11H7NO5/c13-9-6-3-5(10(14)15)1-2-8(6)12-4-7(9)11(16)17/h1-4,7H,(H,14,15)(H,16,17)
InChIKeyJZKHQRDNARCVAT-UHFFFAOYSA-N
MW233.18 g/mol
LogP0.98
Rot. Bonds2

About 4-oxo-3H-quinoline-3,6-dicarboxylic acid

4-oxo-3H-quinoline-3,6-dicarboxylic acid (PubChem CID 75682864) has the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. Its IUPAC name is 4-oxo-3H-quinoline-3,6-dicarboxylic acid.

Molecular Properties

Compound Name4-oxo-3H-quinoline-3,6-dicarboxylic acid
PubChem CID75682864
Molecular FormulaC11H7NO5
Molecular Weight233.18 g/mol
Exact Mass233.03
IUPAC Name4-oxo-3H-quinoline-3,6-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(=O)C(C(=O)O)C=N2
InChIInChI=1S/C11H7NO5/c13-9-6-3-5(10(14)15)1-2-8(6)12-4-7(9)11(16)17/h1-4,7H,(H,14,15)(H,16,17)
InChIKeyJZKHQRDNARCVAT-UHFFFAOYSA-N
XLogP0.98
TPSA104.03 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.18
LogP ≤ 50.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-oxo-3H-quinoline-3,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-3H-quinoline-3,6-dicarboxylic acid?
The IUPAC name of 4-oxo-3H-quinoline-3,6-dicarboxylic acid (CID 75682864) is 4-oxo-3H-quinoline-3,6-dicarboxylic acid.
What is the SMILES notation for 4-oxo-3H-quinoline-3,6-dicarboxylic acid?
The canonical SMILES for 4-oxo-3H-quinoline-3,6-dicarboxylic acid is O=C(O)c1ccc2c(c1)C(=O)C(C(=O)O)C=N2.
What is the InChIKey of 4-oxo-3H-quinoline-3,6-dicarboxylic acid?
The InChIKey is JZKHQRDNARCVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO5/c13-9-6-3-5(10(14)15)1-2-8(6)12-4-7(9)11(16)17/h1-4,7H,(H,14,15)(H,16,17).
What are the key properties of 4-oxo-3H-quinoline-3,6-dicarboxylic acid?
4-oxo-3H-quinoline-3,6-dicarboxylic acid has a molecular weight of 233.18 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3H-quinoline-3,6-dicarboxylic acid is sourced from PubChem (CID 75682864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).