C11H7NO5 — CID 75682864
4-oxo-3H-quinoline-3,6-dicarboxylic acid (PubChem CID 75682864) has the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. Its IUPAC name is 4-oxo-3H-quinoline-3,6-dicarboxylic acid.
| Compound Name | 4-oxo-3H-quinoline-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 75682864 |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 4-oxo-3H-quinoline-3,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)C(C(=O)O)C=N2 |
| InChI | InChI=1S/C11H7NO5/c13-9-6-3-5(10(14)15)1-2-8(6)12-4-7(9)11(16)17/h1-4,7H,(H,14,15)(H,16,17) |
| InChIKey | JZKHQRDNARCVAT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|