C17H29N6O3+ — CID 75688348
8-[(4-ethylpiperazin-1-yl)methyl]-7-(2-methoxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75688348) has the molecular formula C17H29N6O3+ and a molecular weight of 365.46 g/mol. Its IUPAC name is 8-[(4-ethylpiperazin-1-yl)methyl]-7-(2-methoxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(4-ethylpiperazin-1-yl)methyl]-7-(2-methoxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75688348 |
| Molecular Formula | C17H29N6O3+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 8-[(4-ethylpiperazin-1-yl)methyl]-7-(2-methoxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCN1CCN(CC2=[N+](CCOC)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C17H29N6O3/c1-5-21-6-8-22(9-7-21)12-13-18-15-14(23(13)10-11-26-4)16(24)20(3)17(25)19(15)2/h14H,5-12H2,1-4H3/q+1 |
| InChIKey | XCYARVFIASPDRK-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|