C21H25NO8 — CID 7586940
4-O-[2-(4-methoxyphenoxy)ethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 7586940) has the molecular formula C21H25NO8 and a molecular weight of 419.43 g/mol. Its IUPAC name is 4-O-[2-(4-methoxyphenoxy)ethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-(4-methoxyphenoxy)ethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 7586940 |
| Molecular Formula | C21H25NO8 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-O-[2-(4-methoxyphenoxy)ethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C(=O)OC)[C@@H]1C(=O)OCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25NO8/c1-12-16(19(23)27-4)18(17(13(2)22-12)20(24)28-5)21(25)30-11-10-29-15-8-6-14(26-3)7-9-15/h6-9,16,18H,10-11H2,1-5H3/t16?,18-/m0/s1 |
| InChIKey | SLYZENNZGXTHDR-DAFXYXGESA-N |
| XLogP | 1.94 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|