C20H28N2O7 — CID 7226079
4-O-[2-(cyclohexylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 7226079) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-O-[2-(cyclohexylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-(cyclohexylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 7226079 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-O-[2-(cyclohexylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C(=O)OC)[C@@H]1C(=O)OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H28N2O7/c1-11-15(18(24)27-3)17(16(12(2)21-11)19(25)28-4)20(26)29-10-14(23)22-13-8-6-5-7-9-13/h13,15,17H,5-10H2,1-4H3,(H,22,23)/t15?,17-/m0/s1 |
| InChIKey | FHXCXNMCVMEGKQ-LWKPJOBUSA-N |
| XLogP | 1.31 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|