C17H24N2O8 — CID 7226032
4-O-[2-(2-methoxyethylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 7226032) has the molecular formula C17H24N2O8 and a molecular weight of 384.39 g/mol. Its IUPAC name is 4-O-[2-(2-methoxyethylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-(2-methoxyethylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 7226032 |
| Molecular Formula | C17H24N2O8 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-O-[2-(2-methoxyethylamino)-2-oxoethyl] 3-O,5-O-dimethyl (4S)-2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | COCCNC(=O)COC(=O)[C@@H]1C(C(=O)OC)=C(C)N=C(C)C1C(=O)OC |
| InChI | InChI=1S/C17H24N2O8/c1-9-12(15(21)25-4)14(13(10(2)19-9)16(22)26-5)17(23)27-8-11(20)18-6-7-24-3/h12,14H,6-8H2,1-5H3,(H,18,20)/t12?,14-/m0/s1 |
| InChIKey | KFAABMQLJPFJCW-PYMCNQPYSA-N |
| XLogP | -0.38 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|