About [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate
[2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 8646690) has the molecular formula C13H19N3O3S
and a molecular weight of 297.38 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| PubChem CID | 8646690 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | Cc1nsc(N)c1C(=O)OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-8-11(12(14)20-16-8)13(18)19-7-10(17)15-9-5-3-2-4-6-9/h9H,2-7,14H2,1H3,(H,15,17) |
| InChIKey | ONIKGYUVOBCNGH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate (CID 8646690) is [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate is Cc1nsc(N)c1C(=O)OCC(=O)NC1CCCCC1.
What is the InChIKey of [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is ONIKGYUVOBCNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3S/c1-8-11(12(14)20-16-8)13(18)19-7-10(17)15-9-5-3-2-4-6-9/h9H,2-7,14H2,1H3,(H,15,17).
What are the key properties of [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
[2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 297.38 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclohexylamino)-2-oxoethyl] 5-amino-3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 8646690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).