C20H17Cl2NO4S — CID 75929291
4-[3-(6,8-dichloro-2H-chromen-3-yl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 75929291) has the molecular formula C20H17Cl2NO4S and a molecular weight of 438.33 g/mol. Its IUPAC name is 4-[3-(6,8-dichloro-2H-chromen-3-yl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[3-(6,8-dichloro-2H-chromen-3-yl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 75929291 |
| Molecular Formula | C20H17Cl2NO4S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 4-[3-(6,8-dichloro-2H-chromen-3-yl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)C=CC2=Cc3cc(Cl)cc(Cl)c3OC2)cc1 |
| InChI | InChI=1S/C20H17Cl2NO4S/c1-23(2)28(25,26)17-6-4-14(5-7-17)19(24)8-3-13-9-15-10-16(21)11-18(22)20(15)27-12-13/h3-11H,12H2,1-2H3 |
| InChIKey | RJVCCNJJHQQTNP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|