About 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide
3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide (PubChem CID 75929503) has the molecular formula C23H28N2O3S
and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide |
| PubChem CID | 75929503 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc(CN3CCSCC3)cc2C)cc1OC |
| InChI | InChI=1S/C23H28N2O3S/c1-17-14-19(16-25-10-12-29-13-11-25)4-7-20(17)24-23(26)9-6-18-5-8-21(27-2)22(15-18)28-3/h4-9,14-15H,10-13,16H2,1-3H3,(H,24,26) |
| InChIKey | WBMUOLVVDMXTGZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide (CID 75929503) is 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide is COc1ccc(C=CC(=O)Nc2ccc(CN3CCSCC3)cc2C)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide?
The InChIKey is WBMUOLVVDMXTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3S/c1-17-14-19(16-25-10-12-29-13-11-25)4-7-20(17)24-23(26)9-6-18-5-8-21(27-2)22(15-18)28-3/h4-9,14-15H,10-13,16H2,1-3H3,(H,24,26).
What are the key properties of 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide?
3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide has a molecular weight of 412.56 g/mol, XLogP of 4.21, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-N-[2-methyl-4-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide is sourced from PubChem (CID 75929503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).