C19H18ClNO6 — CID 7603505
(7-chloro-1,3-benzodioxol-5-yl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 7603505) has the molecular formula C19H18ClNO6 and a molecular weight of 391.81 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7603505 |
| Molecular Formula | C19H18ClNO6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)OCc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H18ClNO6/c20-14-7-11(8-15-17(14)27-10-26-15)9-25-16(22)5-6-21-18(23)12-3-1-2-4-13(12)19(21)24/h1-2,7-8,12-13H,3-6,9-10H2/t12-,13-/m1/s1 |
| InChIKey | AFWZQVXHXMYGOL-CHWSQXEVSA-N |
| XLogP | 2.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|