C20H22ClNO6 — CID 7635259
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 7635259) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7635259 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C20H22ClNO6/c21-14-7-12-9-26-11-28-18(12)13(8-14)10-27-17(23)5-6-22-19(24)15-3-1-2-4-16(15)20(22)25/h7-8,15-16H,1-6,9-11H2/t15-,16+ |
| InChIKey | CTRODNLADBYZGA-IYBDPMFKSA-N |
| XLogP | 2.82 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|