C17H16ClNO4 — CID 8581196
(3aR,7aR)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 8581196) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is (3aR,7aR)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 8581196 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (3aR,7aR)-2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1Cc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C17H16ClNO4/c18-12-5-10(15-11(6-12)8-22-9-23-15)7-19-16(20)13-3-1-2-4-14(13)17(19)21/h1-2,5-6,13-14H,3-4,7-9H2/t13-,14-/m1/s1 |
| InChIKey | ZFXQBNPRVYACOX-ZIAGYGMSSA-N |
| XLogP | 2.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|