C18H21ClN2O6 — CID 7691278
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7691278) has the molecular formula C18H21ClN2O6 and a molecular weight of 396.83 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7691278 |
| Molecular Formula | C18H21ClN2O6 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCc2cc(Cl)cc3c2OCOC3)C1=O |
| InChI | InChI=1S/C18H21ClN2O6/c1-3-18(4-2)16(23)21(17(24)20-18)7-14(22)26-9-12-6-13(19)5-11-8-25-10-27-15(11)12/h5-6H,3-4,7-10H2,1-2H3,(H,20,24) |
| InChIKey | UMEUVVBATICZED-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|