C20H17N3O3 — CID 7604007
[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7604007) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7604007 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1c[nH]c2ccccc12)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H17N3O3/c1-13(19-22-23-20(26-19)14-7-3-2-4-8-14)25-18(24)11-15-12-21-17-10-6-5-9-16(15)17/h2-10,12-13,21H,11H2,1H3/t13-/m1/s1 |
| InChIKey | CYRWUMOHDQSHOM-CYBMUJFWSA-N |
| XLogP | 4.06 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |