C17H23N2O4+ — CID 172880053
[3-carboxy-2-[2-(1H-indol-3-yl)acetyl]oxypropyl]-trimethylazanium (PubChem CID 172880053) has the molecular formula C17H23N2O4+ and a molecular weight of 319.38 g/mol. Its IUPAC name is [3-carboxy-2-[2-(1H-indol-3-yl)acetyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[2-(1H-indol-3-yl)acetyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 172880053 |
| Molecular Formula | C17H23N2O4+ |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [3-carboxy-2-[2-(1H-indol-3-yl)acetyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2O4/c1-19(2,3)11-13(9-16(20)21)23-17(22)8-12-10-18-15-7-5-4-6-14(12)15/h4-7,10,13,18H,8-9,11H2,1-3H3/p+1 |
| InChIKey | PBMNAYVZYLZVKC-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|