About [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate
[(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7663759) has the molecular formula C18H16FNO2
and a molecular weight of 297.33 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 7663759 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | C[C@H](OC(=O)Cc1c[nH]c2ccccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO2/c1-12(13-6-8-15(19)9-7-13)22-18(21)10-14-11-20-17-5-3-2-4-16(14)17/h2-9,11-12,20H,10H2,1H3/t12-/m0/s1 |
| InChIKey | IUMSOANGWATZFC-LBPRGKRZSA-N |
| XLogP | 4.15 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate (CID 7663759) is [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate is C[C@H](OC(=O)Cc1c[nH]c2ccccc12)c1ccc(F)cc1.
What is the InChIKey of [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is IUMSOANGWATZFC-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H16FNO2/c1-12(13-6-8-15(19)9-7-13)22-18(21)10-14-11-20-17-5-3-2-4-16(14)17/h2-9,11-12,20H,10H2,1H3/t12-/m0/s1.
What are the key properties of [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate?
[(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 297.33 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(4-fluorophenyl)ethyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 7663759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).