C21H17F3N4O2 — CID 7614686
2-(benzotriazol-1-yl)-1-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethanone (PubChem CID 7614686) has the molecular formula C21H17F3N4O2 and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-1-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethanone.
| Compound Name | 2-(benzotriazol-1-yl)-1-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 7614686 |
| Molecular Formula | C21H17F3N4O2 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-(benzotriazol-1-yl)-1-[2,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)Cn2nnc3ccccc32)c(C)n1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F3N4O2/c1-13-11-17(20(29)12-27-19-6-4-3-5-18(19)25-26-27)14(2)28(13)15-7-9-16(10-8-15)30-21(22,23)24/h3-11H,12H2,1-2H3 |
| InChIKey | PTQVIRWDVGLYNQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|