C16H20N2O5 — CID 7617153
[(3S)-2-oxooxolan-3-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617153) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617153 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)O[C@H]1CCOC1=O |
| InChI | InChI=1S/C16H20N2O5/c1-10(2)13(15(20)23-12-8-9-22-14(12)19)18-16(21)17-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H2,17,18,21)/t12-,13+/m0/s1 |
| InChIKey | ZBTVAEXYVUNJJC-QWHCGFSZSA-N |
| XLogP | 1.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |