C17H21NO5 — CID 8848057
[(3S)-2-oxooxolan-3-yl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 8848057) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 8848057 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)O[C@H]1CCOC1=O |
| InChI | InChI=1S/C17H21NO5/c1-11(2)15(17(21)23-13-8-9-22-16(13)20)18-14(19)10-12-6-4-3-5-7-12/h3-7,11,13,15H,8-10H2,1-2H3,(H,18,19)/t13-,15-/m0/s1 |
| InChIKey | ZKBOGHXRCVJFSZ-ZFWWWQNUSA-N |
| XLogP | 1.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |