C17H14BrClN2O2 — CID 7629417
2-(4-bromo-2-chloro-6-methylphenoxy)-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 7629417) has the molecular formula C17H14BrClN2O2 and a molecular weight of 393.67 g/mol. Its IUPAC name is 2-(4-bromo-2-chloro-6-methylphenoxy)-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-(4-bromo-2-chloro-6-methylphenoxy)-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7629417 |
| Molecular Formula | C17H14BrClN2O2 |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2-(4-bromo-2-chloro-6-methylphenoxy)-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | Cc1cc(Br)cc(Cl)c1OCC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C17H14BrClN2O2/c1-11-8-13(18)9-15(19)17(11)23-10-16(22)21-14-4-2-12(3-5-14)6-7-20/h2-5,8-9H,6,10H2,1H3,(H,21,22) |
| InChIKey | QYNYRSWWLZSPHG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |