About [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate
[2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 7633656) has the molecular formula C11H13Cl3N3O3+
and a molecular weight of 341.60 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| PubChem CID | 7633656 |
| Molecular Formula | C11H13Cl3N3O3+ |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | CCCNC(=O)COC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C11H12Cl3N3O3/c1-2-3-16-5(18)4-20-11(19)9-6(12)8(15)7(13)10(14)17-9/h2-4H2,1H3,(H2,15,17)(H,16,18)/p+1 |
| InChIKey | SLKMHXUNGQEGRD-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate?
The IUPAC name of [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (CID 7633656) is [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
What is the SMILES notation for [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate?
The canonical SMILES for [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate is CCCNC(=O)COC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl.
What is the InChIKey of [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate?
The InChIKey is SLKMHXUNGQEGRD-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H12Cl3N3O3/c1-2-3-16-5(18)4-20-11(19)9-6(12)8(15)7(13)10(14)17-9/h2-4H2,1H3,(H2,15,17)(H,16,18)/p+1.
What are the key properties of [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate?
[2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate has a molecular weight of 341.60 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(propylamino)ethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate is sourced from PubChem (CID 7633656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).