C15H19Cl3N3O3+ — CID 7633811
[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 7633811) has the molecular formula C15H19Cl3N3O3+ and a molecular weight of 395.69 g/mol. Its IUPAC name is [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
| Compound Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7633811 |
| Molecular Formula | C15H19Cl3N3O3+ |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)COC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)C1 |
| InChI | InChI=1S/C15H18Cl3N3O3/c1-7-3-8(2)5-21(4-7)9(22)6-24-15(23)13-10(16)12(19)11(17)14(18)20-13/h7-8H,3-6H2,1-2H3,(H2,19,20)/p+1/t7-,8-/m1/s1 |
| InChIKey | GMCJUALXIRGKFU-HTQZYQBOSA-O |
| XLogP | 2.70 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|