C18H18ClN3O4 — CID 7641355
(3'aS)-6'-chloro-1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-carbaldehyde (PubChem CID 7641355) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is (3'aS)-6'-chloro-1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-carbaldehyde.
| Compound Name | (3'aS)-6'-chloro-1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-carbaldehyde |
|---|---|
| PubChem CID | 7641355 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3'aS)-6'-chloro-1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-carbaldehyde |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3c(ccc(C=O)c3Cl)N3CCC[C@H]32)C1=O |
| InChI | InChI=1S/C18H18ClN3O4/c1-20-15(24)18(16(25)21(2)17(20)26)8-11-12(22-7-3-4-13(18)22)6-5-10(9-23)14(11)19/h5-6,9,13H,3-4,7-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | XFVABQFPVYCTNH-ZDUSSCGKSA-N |
| XLogP | 1.71 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|