C21H26FN3O4 — CID 7643232
(1R,3S,3aR,6aS)-5'-fluoro-5-(3-methoxypropyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7643232) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5'-fluoro-5-(3-methoxypropyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-5'-fluoro-5-(3-methoxypropyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7643232 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (1R,3S,3aR,6aS)-5'-fluoro-5-(3-methoxypropyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCCN1C(=O)[C@H]2[C@@H](C1=O)[C@@]1(N[C@@H]2CC(C)C)C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C21H26FN3O4/c1-11(2)9-15-16-17(19(27)25(18(16)26)7-4-8-29-3)21(24-15)13-10-12(22)5-6-14(13)23-20(21)28/h5-6,10-11,15-17,24H,4,7-9H2,1-3H3,(H,23,28)/t15-,16-,17+,21-/m1/s1 |
| InChIKey | PMQGRELRZUNVEY-PZTGFMGMSA-N |
| XLogP | 1.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|