C23H29N2O3+ — CID 7646632
N-(3,5-dimethylphenyl)-2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide (PubChem CID 7646632) has the molecular formula C23H29N2O3+ and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide |
|---|---|
| PubChem CID | 7646632 |
| Molecular Formula | C23H29N2O3+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)C[NH+]2CCc3cc4c(cc3[C@@H]2C)OCCCO4)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-15-9-16(2)11-19(10-15)24-23(26)14-25-6-5-18-12-21-22(13-20(18)17(25)3)28-8-4-7-27-21/h9-13,17H,4-8,14H2,1-3H3,(H,24,26)/p+1/t17-/m0/s1 |
| InChIKey | DHKWCTUHPRXWKA-KRWDZBQOSA-O |
| XLogP | 2.61 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |