C23H27N2O4+ — CID 7677874
N-(3-acetylphenyl)-2-[(7R)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide (PubChem CID 7677874) has the molecular formula C23H27N2O4+ and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(7R)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[(7R)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide |
|---|---|
| PubChem CID | 7677874 |
| Molecular Formula | C23H27N2O4+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(7R)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)C[NH+]2CCc3cc4c(cc3[C@H]2C)OCCCO4)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-15-20-13-22-21(28-9-4-10-29-22)12-18(20)7-8-25(15)14-23(27)24-19-6-3-5-17(11-19)16(2)26/h3,5-6,11-13,15H,4,7-10,14H2,1-2H3,(H,24,27)/p+1/t15-/m1/s1 |
| InChIKey | KTXSHSBMTMNEQH-OAHLLOKOSA-O |
| XLogP | 2.19 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |