C21H22F3N2O3+ — CID 7678053
2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7678053) has the molecular formula C21H22F3N2O3+ and a molecular weight of 407.41 g/mol. Its IUPAC name is 2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7678053 |
| Molecular Formula | C21H22F3N2O3+ |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[(7S)-7-methyl-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]isoquinolin-8-ium-8-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C[C@H]1c2cc3c(cc2CC[NH+]1CC(=O)Nc1ccc(F)c(F)c1F)OCCCO3 |
| InChI | InChI=1S/C21H21F3N2O3/c1-12-14-10-18-17(28-7-2-8-29-18)9-13(14)5-6-26(12)11-19(27)25-16-4-3-15(22)20(23)21(16)24/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,25,27)/p+1/t12-/m0/s1 |
| InChIKey | XPIMYRCLMNIGNQ-LBPRGKRZSA-O |
| XLogP | 2.41 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|