C14H14N4O5 — CID 7646973
(5R)-1,1'-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 7646973) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is (5R)-1,1'-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | (5R)-1,1'-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 7646973 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (5R)-1,1'-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | CN1C(=O)NC(=O)[C@]2(Cc3cc([N+](=O)[O-])ccc3N(C)C2)C1=O |
| InChI | InChI=1S/C14H14N4O5/c1-16-7-14(11(19)15-13(21)17(2)12(14)20)6-8-5-9(18(22)23)3-4-10(8)16/h3-5H,6-7H2,1-2H3,(H,15,19,21)/t14-/m1/s1 |
| InChIKey | IOCDTAKKEQWREO-CQSZACIVSA-N |
| XLogP | 0.28 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|