C18H22N4O7 — CID 4871324
1'-(2,2-dimethoxyethyl)-1,3-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 4871324) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is 1'-(2,2-dimethoxyethyl)-1,3-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | 1'-(2,2-dimethoxyethyl)-1,3-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4871324 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1'-(2,2-dimethoxyethyl)-1,3-dimethyl-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | COC(CN1CC2(Cc3cc([N+](=O)[O-])ccc31)C(=O)N(C)C(=O)N(C)C2=O)OC |
| InChI | InChI=1S/C18H22N4O7/c1-19-15(23)18(16(24)20(2)17(19)25)8-11-7-12(22(26)27)5-6-13(11)21(10-18)9-14(28-3)29-4/h5-7,14H,8-10H2,1-4H3 |
| InChIKey | NZNLKGNTOWYCIO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 122.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|