About bis(cyclopenta-1,3-diene);dichlorotungsten
bis(cyclopenta-1,3-diene);dichlorotungsten (PubChem CID 76518723) has the molecular formula C10H10Cl2W-2
and a molecular weight of 384.94 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);dichlorotungsten.
Molecular Properties
| Compound Name | bis(cyclopenta-1,3-diene);dichlorotungsten |
| PubChem CID | 76518723 |
| Molecular Formula | C10H10Cl2W-2 |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | bis(cyclopenta-1,3-diene);dichlorotungsten |
| SMILES | Cl[W]Cl.[C-]1=CC=CC1.[C-]1=CC=CC1 |
| InChI | InChI=1S/2C5H5.2ClH.W/c2*1-2-4-5-3-1;;;/h2*1-3H,4H2;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | DSECQQNIMXMFHP-UHFFFAOYSA-L |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-1,3-diene);dichlorotungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-1,3-diene);dichlorotungsten?
The IUPAC name of bis(cyclopenta-1,3-diene);dichlorotungsten (CID 76518723) is bis(cyclopenta-1,3-diene);dichlorotungsten.
What is the SMILES notation for bis(cyclopenta-1,3-diene);dichlorotungsten?
The canonical SMILES for bis(cyclopenta-1,3-diene);dichlorotungsten is Cl[W]Cl.[C-]1=CC=CC1.[C-]1=CC=CC1.
What is the InChIKey of bis(cyclopenta-1,3-diene);dichlorotungsten?
The InChIKey is DSECQQNIMXMFHP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H5.2ClH.W/c2*1-2-4-5-3-1;;;/h2*1-3H,4H2;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of bis(cyclopenta-1,3-diene);dichlorotungsten?
bis(cyclopenta-1,3-diene);dichlorotungsten has a molecular weight of 384.94 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-1,3-diene);dichlorotungsten is sourced from PubChem (CID 76518723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).