C27H32N2O6 — CID 76528768
methyl 3-[[[6-[2-(oxan-4-ylmethylamino)-2-oxoethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxymethyl]benzoate (PubChem CID 76528768) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl 3-[[[6-[2-(oxan-4-ylmethylamino)-2-oxoethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxymethyl]benzoate.
| Compound Name | methyl 3-[[[6-[2-(oxan-4-ylmethylamino)-2-oxoethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 76528768 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | methyl 3-[[[6-[2-(oxan-4-ylmethylamino)-2-oxoethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(CON=C2CCCc3cc(OCC(=O)NCC4CCOCC4)ccc32)c1 |
| InChI | InChI=1S/C27H32N2O6/c1-32-27(31)22-6-2-4-20(14-22)17-35-29-25-7-3-5-21-15-23(8-9-24(21)25)34-18-26(30)28-16-19-10-12-33-13-11-19/h2,4,6,8-9,14-15,19H,3,5,7,10-13,16-18H2,1H3,(H,28,30) |
| InChIKey | CTGDRNOTBLMTJS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|