About 1-bromoprop-1-en-1-ol
1-bromoprop-1-en-1-ol (PubChem CID 76545266) has the molecular formula C3H5BrO
and a molecular weight of 136.98 g/mol. Its IUPAC name is 1-bromoprop-1-en-1-ol.
Molecular Properties
| Compound Name | 1-bromoprop-1-en-1-ol |
| PubChem CID | 76545266 |
| Molecular Formula | C3H5BrO |
| Molecular Weight | 136.98 g/mol |
| Exact Mass | 135.95 |
| IUPAC Name | 1-bromoprop-1-en-1-ol |
| SMILES | CC=C(O)Br |
| InChI | InChI=1S/C3H5BrO/c1-2-3(4)5/h2,5H,1H3 |
| InChIKey | PBPAFHRJPGQGCI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.98 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoprop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoprop-1-en-1-ol?
The IUPAC name of 1-bromoprop-1-en-1-ol (CID 76545266) is 1-bromoprop-1-en-1-ol.
What is the SMILES notation for 1-bromoprop-1-en-1-ol?
The canonical SMILES for 1-bromoprop-1-en-1-ol is CC=C(O)Br.
What is the InChIKey of 1-bromoprop-1-en-1-ol?
The InChIKey is PBPAFHRJPGQGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrO/c1-2-3(4)5/h2,5H,1H3.
What are the key properties of 1-bromoprop-1-en-1-ol?
1-bromoprop-1-en-1-ol has a molecular weight of 136.98 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoprop-1-en-1-ol is sourced from PubChem (CID 76545266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).