C19H26N6O — CID 76549139
2-[(2-aminocyclohexyl)amino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide (PubChem CID 76549139) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-[(2-aminocyclohexyl)amino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[(2-aminocyclohexyl)amino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 76549139 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[(2-aminocyclohexyl)amino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCCCC2N)nc1NCCc1ccccc1 |
| InChI | InChI=1S/C19H26N6O/c20-15-8-4-5-9-16(15)24-19-23-12-14(17(21)26)18(25-19)22-11-10-13-6-2-1-3-7-13/h1-3,6-7,12,15-16H,4-5,8-11,20H2,(H2,21,26)(H2,22,23,24,25) |
| InChIKey | URVSGZXLNDSPLG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |