C18H20NO5S2- — CID 7655338
(2R)-2-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 7655338) has the molecular formula C18H20NO5S2- and a molecular weight of 394.49 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | (2R)-2-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 7655338 |
| Molecular Formula | C18H20NO5S2- |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCCC[C@H](C(=O)[O-])N1C(=O)/C(=C/c2cc(OC)ccc2OC)SC1=S |
| InChI | InChI=1S/C18H21NO5S2/c1-4-5-6-13(17(21)22)19-16(20)15(26-18(19)25)10-11-9-12(23-2)7-8-14(11)24-3/h7-10,13H,4-6H2,1-3H3,(H,21,22)/p-1/b15-10-/t13-/m1/s1 |
| InChIKey | QPKBHMSFKKBDLP-NWFCWYBLSA-M |
| XLogP | 2.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|